C12H26NO5S+ — CID 174715685
(3-but-3-en-2-yloxy-2-hydroxypropyl)-dimethyl-(3-sulfopropyl)azanium (PubChem CID 174715685) has the molecular formula C12H26NO5S+ and a molecular weight of 296.41 g/mol. Its IUPAC name is (3-but-3-en-2-yloxy-2-hydroxypropyl)-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | (3-but-3-en-2-yloxy-2-hydroxypropyl)-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 174715685 |
| Molecular Formula | C12H26NO5S+ |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3-but-3-en-2-yloxy-2-hydroxypropyl)-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C=CC(C)OCC(O)C[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C12H25NO5S/c1-5-11(2)18-10-12(14)9-13(3,4)7-6-8-19(15,16)17/h5,11-12,14H,1,6-10H2,2-4H3/p+1 |
| InChIKey | WVNQOXCVHMXCHX-UHFFFAOYSA-O |
| XLogP | 0.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|