C21H17N2O4S- — CID 174716084
benzene-1,4-dicarboxamide;1H-phenalene-1-sulfinate (PubChem CID 174716084) has the molecular formula C21H17N2O4S- and a molecular weight of 393.44 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;1H-phenalene-1-sulfinate.
| Compound Name | benzene-1,4-dicarboxamide;1H-phenalene-1-sulfinate |
|---|---|
| PubChem CID | 174716084 |
| Molecular Formula | C21H17N2O4S- |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | benzene-1,4-dicarboxamide;1H-phenalene-1-sulfinate |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.O=S([O-])C1C=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H10O2S.C8H8N2O2/c14-16(15)12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10;9-7(11)5-1-2-6(4-3-5)8(10)12/h1-8,12H,(H,14,15);1-4H,(H2,9,11)(H2,10,12)/p-1 |
| InChIKey | ZGQICDUQFAQGNS-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|