C20H22N4O3 — CID 174718374
amino 4-[5-[(4-carbamimidoylphenyl)methoxy]-1H-indol-3-yl]butanoate (PubChem CID 174718374) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is amino 4-[5-[(4-carbamimidoylphenyl)methoxy]-1H-indol-3-yl]butanoate.
| Compound Name | amino 4-[5-[(4-carbamimidoylphenyl)methoxy]-1H-indol-3-yl]butanoate |
|---|---|
| PubChem CID | 174718374 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | amino 4-[5-[(4-carbamimidoylphenyl)methoxy]-1H-indol-3-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(COc2ccc3[nH]cc(CCCC(=O)ON)c3c2)cc1 |
| InChI | InChI=1S/C20H22N4O3/c21-20(22)14-6-4-13(5-7-14)12-26-16-8-9-18-17(10-16)15(11-24-18)2-1-3-19(25)27-23/h4-11,24H,1-3,12,23H2,(H3,21,22) |
| InChIKey | UGRHZYLIPALGTK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|