C15H15NO7S2 — CID 174719071
2-[2-(4-methylsulfonyl-2-nitrobenzoyl)thian-3-yl]-2-oxoacetaldehyde (PubChem CID 174719071) has the molecular formula C15H15NO7S2 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[2-(4-methylsulfonyl-2-nitrobenzoyl)thian-3-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-(4-methylsulfonyl-2-nitrobenzoyl)thian-3-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174719071 |
| Molecular Formula | C15H15NO7S2 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-[2-(4-methylsulfonyl-2-nitrobenzoyl)thian-3-yl]-2-oxoacetaldehyde |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C2SCCCC2C(=O)C=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15NO7S2/c1-25(22,23)9-4-5-10(12(7-9)16(20)21)14(19)15-11(13(18)8-17)3-2-6-24-15/h4-5,7-8,11,15H,2-3,6H2,1H3 |
| InChIKey | XYEFIRKQEUONJN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 128.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|