C18H12F6 — CID 174719569
1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene (PubChem CID 174719569) has the molecular formula C18H12F6 and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene.
| Compound Name | 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene |
|---|---|
| PubChem CID | 174719569 |
| Molecular Formula | C18H12F6 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene |
| SMILES | FC(F)(F)C=Cc1cccc(-c2ccccc2)c1C=CC(F)(F)F |
| InChI | InChI=1S/C18H12F6/c19-17(20,21)11-9-14-7-4-8-15(13-5-2-1-3-6-13)16(14)10-12-18(22,23)24/h1-12H |
| InChIKey | QLEXXRXFSUDWIT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |