About 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene
1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene (PubChem CID 174719569) has the molecular formula C18H12F6
and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene.
Molecular Properties
| Compound Name | 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene |
| PubChem CID | 174719569 |
| Molecular Formula | C18H12F6 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene |
| SMILES | FC(F)(F)C=Cc1cccc(-c2ccccc2)c1C=CC(F)(F)F |
| InChI | InChI=1S/C18H12F6/c19-17(20,21)11-9-14-7-4-8-15(13-5-2-1-3-6-13)16(14)10-12-18(22,23)24/h1-12H |
| InChIKey | QLEXXRXFSUDWIT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene?
The IUPAC name of 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene (CID 174719569) is 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene.
What is the SMILES notation for 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene?
The canonical SMILES for 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene is FC(F)(F)C=Cc1cccc(-c2ccccc2)c1C=CC(F)(F)F.
What is the InChIKey of 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene?
The InChIKey is QLEXXRXFSUDWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F6/c19-17(20,21)11-9-14-7-4-8-15(13-5-2-1-3-6-13)16(14)10-12-18(22,23)24/h1-12H.
What are the key properties of 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene?
1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene has a molecular weight of 342.28 g/mol, XLogP of 6.50, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2,3-bis(3,3,3-trifluoroprop-1-enyl)benzene is sourced from PubChem (CID 174719569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).