C25H30Br2N2O3 — CID 174721733
1,5-dibromo-1,5-bis(4-morpholin-4-ylphenyl)pentan-3-one (PubChem CID 174721733) has the molecular formula C25H30Br2N2O3 and a molecular weight of 566.33 g/mol. Its IUPAC name is 1,5-dibromo-1,5-bis(4-morpholin-4-ylphenyl)pentan-3-one.
| Compound Name | 1,5-dibromo-1,5-bis(4-morpholin-4-ylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174721733 |
| Molecular Formula | C25H30Br2N2O3 |
| Molecular Weight | 566.33 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | 1,5-dibromo-1,5-bis(4-morpholin-4-ylphenyl)pentan-3-one |
| SMILES | O=C(CC(Br)c1ccc(N2CCOCC2)cc1)CC(Br)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H30Br2N2O3/c26-24(19-1-5-21(6-2-19)28-9-13-31-14-10-28)17-23(30)18-25(27)20-3-7-22(8-4-20)29-11-15-32-16-12-29/h1-8,24-25H,9-18H2 |
| InChIKey | FGULOQJARGHZPP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|