C9H12BrN — CID 174721738
3-(2-bromoethyl)-2,4-dimethylpyridine (PubChem CID 174721738) has the molecular formula C9H12BrN and a molecular weight of 214.11 g/mol. Its IUPAC name is 3-(2-bromoethyl)-2,4-dimethylpyridine.
| Compound Name | 3-(2-bromoethyl)-2,4-dimethylpyridine |
|---|---|
| PubChem CID | 174721738 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-(2-bromoethyl)-2,4-dimethylpyridine |
| SMILES | Cc1ccnc(C)c1CCBr |
| InChI | InChI=1S/C9H12BrN/c1-7-4-6-11-8(2)9(7)3-5-10/h4,6H,3,5H2,1-2H3 |
| InChIKey | MMJOPKANOYQQGJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|