C33H41F3N5O3P — CID 174722179
7-[[2-(3-dipropylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-4-(4-hydroxycyclohexyl)-2-methyl-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174722179) has the molecular formula C33H41F3N5O3P and a molecular weight of 643.69 g/mol. Its IUPAC name is 7-[[2-(3-dipropylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-4-(4-hydroxycyclohexyl)-2-methyl-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 7-[[2-(3-dipropylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-4-(4-hydroxycyclohexyl)-2-methyl-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174722179 |
| Molecular Formula | C33H41F3N5O3P |
| Molecular Weight | 643.69 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | 7-[[2-(3-dipropylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-4-(4-hydroxycyclohexyl)-2-methyl-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | CCCP(=O)(CCC)c1cccc(Nc2ncc(C(F)(F)F)c(Nc3ccc(C4CCC(O)CC4)c4c3C(C=O)N(C)C4)n2)c1 |
| InChI | InChI=1S/C33H41F3N5O3P/c1-4-15-45(44,16-5-2)24-8-6-7-22(17-24)38-32-37-18-27(33(34,35)36)31(40-32)39-28-14-13-25(21-9-11-23(43)12-10-21)26-19-41(3)29(20-42)30(26)28/h6-8,13-14,17-18,20-21,23,29,43H,4-5,9-12,15-16,19H2,1-3H3,(H2,37,38,39,40) |
| InChIKey | AOTVSYGCIASCIC-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.69 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|