C20H22N2O9S — CID 174724914
(2-oxo-2-phenylmethoxyethyl) 3-[(2-amino-2-oxoethyl)-(sulfinooxymethyl)amino]-4-methoxybenzoate (PubChem CID 174724914) has the molecular formula C20H22N2O9S and a molecular weight of 466.47 g/mol. Its IUPAC name is (2-oxo-2-phenylmethoxyethyl) 3-[(2-amino-2-oxoethyl)-(sulfinooxymethyl)amino]-4-methoxybenzoate.
| Compound Name | (2-oxo-2-phenylmethoxyethyl) 3-[(2-amino-2-oxoethyl)-(sulfinooxymethyl)amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 174724914 |
| Molecular Formula | C20H22N2O9S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | (2-oxo-2-phenylmethoxyethyl) 3-[(2-amino-2-oxoethyl)-(sulfinooxymethyl)amino]-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)OCc2ccccc2)cc1N(COS(=O)O)CC(N)=O |
| InChI | InChI=1S/C20H22N2O9S/c1-28-17-8-7-15(9-16(17)22(10-18(21)23)13-31-32(26)27)20(25)30-12-19(24)29-11-14-5-3-2-4-6-14/h2-9H,10-13H2,1H3,(H2,21,23)(H,26,27) |
| InChIKey | NIFXRBKHTMXFKY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|