C23H27NO9S — CID 89455589
(2-oxo-2-phenylmethoxyethyl) 4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoate (PubChem CID 89455589) has the molecular formula C23H27NO9S and a molecular weight of 493.53 g/mol. Its IUPAC name is (2-oxo-2-phenylmethoxyethyl) 4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoate.
| Compound Name | (2-oxo-2-phenylmethoxyethyl) 4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 89455589 |
| Molecular Formula | C23H27NO9S |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | (2-oxo-2-phenylmethoxyethyl) 4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)OCc2ccccc2)cc1NS(=O)(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27NO9S/c1-23(2,3)33-21(26)15-34(28,29)24-18-12-17(10-11-19(18)30-4)22(27)32-14-20(25)31-13-16-8-6-5-7-9-16/h5-12,24H,13-15H2,1-4H3 |
| InChIKey | JHBCJHFAUKCQBY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|