C16H21NO8S2 — CID 89455945
2-[4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoyl]sulfanylacetic acid (PubChem CID 89455945) has the molecular formula C16H21NO8S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoyl]sulfanylacetic acid.
| Compound Name | 2-[4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 89455945 |
| Molecular Formula | C16H21NO8S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-[4-methoxy-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]benzoyl]sulfanylacetic acid |
| SMILES | COc1ccc(C(=O)SCC(=O)O)cc1NS(=O)(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO8S2/c1-16(2,3)25-14(20)9-27(22,23)17-11-7-10(5-6-12(11)24-4)15(21)26-8-13(18)19/h5-7,17H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | VKYCCWMWCJASLR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|