C16H23F — CID 174725245
1-[1-(3,4-dimethylcyclohexyl)ethyl]-4-fluorobenzene (PubChem CID 174725245) has the molecular formula C16H23F and a molecular weight of 234.36 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylcyclohexyl)ethyl]-4-fluorobenzene.
| Compound Name | 1-[1-(3,4-dimethylcyclohexyl)ethyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 174725245 |
| Molecular Formula | C16H23F |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-[1-(3,4-dimethylcyclohexyl)ethyl]-4-fluorobenzene |
| SMILES | CC1CCC(C(C)c2ccc(F)cc2)CC1C |
| InChI | InChI=1S/C16H23F/c1-11-4-5-15(10-12(11)2)13(3)14-6-8-16(17)9-7-14/h6-9,11-13,15H,4-5,10H2,1-3H3 |
| InChIKey | LFKMIPILNVNEGK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |