2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid

C17H23FO2 — CID 79418546

IUPAC2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid
SMILESCC1CCC(C(Cc2ccc(F)cc2)C(=O)O)CC1C
InChIInChI=1S/C17H23FO2/c1-11-3-6-14(9-12(11)2)16(17(19)20)10-13-4-7-15(18)8-5-13/h4-5,7-8,11-12,14,16H,3,6,9-10H2,1-2H3,(H,19,20)
InChIKeyLZRPCWLJGSGNPL-UHFFFAOYSA-N
MW278.37 g/mol
LogP4.14
Rot. Bonds4

About 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid

2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid (PubChem CID 79418546) has the molecular formula C17H23FO2 and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid.

Molecular Properties

Compound Name2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid
PubChem CID79418546
Molecular FormulaC17H23FO2
Molecular Weight278.37 g/mol
Exact Mass278.17
IUPAC Name2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid
SMILESCC1CCC(C(Cc2ccc(F)cc2)C(=O)O)CC1C
InChIInChI=1S/C17H23FO2/c1-11-3-6-14(9-12(11)2)16(17(19)20)10-13-4-7-15(18)8-5-13/h4-5,7-8,11-12,14,16H,3,6,9-10H2,1-2H3,(H,19,20)
InChIKeyLZRPCWLJGSGNPL-UHFFFAOYSA-N
XLogP4.14
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.37
LogP ≤ 54.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid?
The IUPAC name of 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid (CID 79418546) is 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid.
What is the SMILES notation for 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid?
The canonical SMILES for 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid is CC1CCC(C(Cc2ccc(F)cc2)C(=O)O)CC1C.
What is the InChIKey of 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid?
The InChIKey is LZRPCWLJGSGNPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FO2/c1-11-3-6-14(9-12(11)2)16(17(19)20)10-13-4-7-15(18)8-5-13/h4-5,7-8,11-12,14,16H,3,6,9-10H2,1-2H3,(H,19,20).
What are the key properties of 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid?
2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid has a molecular weight of 278.37 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid is sourced from PubChem (CID 79418546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).