C17H23FO2 — CID 79418546
2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid (PubChem CID 79418546) has the molecular formula C17H23FO2 and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 79418546 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(3,4-dimethylcyclohexyl)-3-(4-fluorophenyl)propanoic acid |
| SMILES | CC1CCC(C(Cc2ccc(F)cc2)C(=O)O)CC1C |
| InChI | InChI=1S/C17H23FO2/c1-11-3-6-14(9-12(11)2)16(17(19)20)10-13-4-7-15(18)8-5-13/h4-5,7-8,11-12,14,16H,3,6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | LZRPCWLJGSGNPL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |