C13H18N2S — CID 174725909
azane;N,5-dimethyl-N-(4-methylphenyl)thiophen-2-amine (PubChem CID 174725909) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is azane;N,5-dimethyl-N-(4-methylphenyl)thiophen-2-amine.
| Compound Name | azane;N,5-dimethyl-N-(4-methylphenyl)thiophen-2-amine |
|---|---|
| PubChem CID | 174725909 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | azane;N,5-dimethyl-N-(4-methylphenyl)thiophen-2-amine |
| SMILES | Cc1ccc(N(C)c2ccc(C)s2)cc1.N |
| InChI | InChI=1S/C13H15NS.H3N/c1-10-4-7-12(8-5-10)14(3)13-9-6-11(2)15-13;/h4-9H,1-3H3;1H3 |
| InChIKey | QYVWYSSZVGLWES-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |