C25H32Cl2N6O6S — CID 174727016
1-[1-(2-amino-5-chlorophenyl)-2-[(2S)-1-[(2R)-2-(benzenesulfonamido)-4-methylpentanoyl]pyrrolidin-2-yl]-2-oxoethyl]-1-nitrosourea;hydrochloride (PubChem CID 174727016) has the molecular formula C25H32Cl2N6O6S and a molecular weight of 615.54 g/mol. Its IUPAC name is 1-[1-(2-amino-5-chlorophenyl)-2-[(2S)-1-[(2R)-2-(benzenesulfonamido)-4-methylpentanoyl]pyrrolidin-2-yl]-2-oxoethyl]-1-nitrosourea;hydrochloride.
| Compound Name | 1-[1-(2-amino-5-chlorophenyl)-2-[(2S)-1-[(2R)-2-(benzenesulfonamido)-4-methylpentanoyl]pyrrolidin-2-yl]-2-oxoethyl]-1-nitrosourea;hydrochloride |
|---|---|
| PubChem CID | 174727016 |
| Molecular Formula | C25H32Cl2N6O6S |
| Molecular Weight | 615.54 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | 1-[1-(2-amino-5-chlorophenyl)-2-[(2S)-1-[(2R)-2-(benzenesulfonamido)-4-methylpentanoyl]pyrrolidin-2-yl]-2-oxoethyl]-1-nitrosourea;hydrochloride |
| SMILES | CC(C)C[C@@H](NS(=O)(=O)c1ccccc1)C(=O)N1CCC[C@H]1C(=O)C(c1cc(Cl)ccc1N)N(N=O)C(N)=O.Cl |
| InChI | InChI=1S/C25H31ClN6O6S.ClH/c1-15(2)13-20(29-39(37,38)17-7-4-3-5-8-17)24(34)31-12-6-9-21(31)23(33)22(32(30-36)25(28)35)18-14-16(26)10-11-19(18)27;/h3-5,7-8,10-11,14-15,20-22,29H,6,9,12-13,27H2,1-2H3,(H2,28,35);1H/t20-,21+,22?;/m1./s1 |
| InChIKey | QUTCONGTYLUGGP-KOFLVCDRSA-N |
| XLogP | 3.40 |
| TPSA | 185.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|