C17H26N4O5S — CID 14858894
(2S)-1-[(2S)-6-amino-2-[(2-aminophenyl)sulfonylamino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 14858894) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[(2-aminophenyl)sulfonylamino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[(2-aminophenyl)sulfonylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14858894 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[(2-aminophenyl)sulfonylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](NS(=O)(=O)c1ccccc1N)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C17H26N4O5S/c18-10-4-3-7-13(16(22)21-11-5-8-14(21)17(23)24)20-27(25,26)15-9-2-1-6-12(15)19/h1-2,6,9,13-14,20H,3-5,7-8,10-11,18-19H2,(H,23,24)/t13-,14-/m0/s1 |
| InChIKey | NIIZWUHEBQUDRZ-KBPBESRZSA-N |
| XLogP | 0.12 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|