About [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol
[diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol (PubChem CID 174727421) has the molecular formula C14H16S3
and a molecular weight of 280.48 g/mol. Its IUPAC name is [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol.
Molecular Properties
| Compound Name | [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol |
| PubChem CID | 174727421 |
| Molecular Formula | C14H16S3 |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol |
| SMILES | SCS(CS)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16S3/c15-11-17(12-16,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | GTOLJCSQGXALSM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol?
The IUPAC name of [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol (CID 174727421) is [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol.
What is the SMILES notation for [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol?
The canonical SMILES for [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol is SCS(CS)(c1ccccc1)c1ccccc1.
What is the InChIKey of [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol?
The InChIKey is GTOLJCSQGXALSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16S3/c15-11-17(12-16,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2.
What are the key properties of [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol?
[diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol has a molecular weight of 280.48 g/mol, XLogP of 4.68, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [diphenyl(sulfanylmethyl)-λ4-sulfanyl]methanethiol is sourced from PubChem (CID 174727421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).