About 4-acridin-1-yloxadiazole
4-acridin-1-yloxadiazole (PubChem CID 174728572) has the molecular formula C15H9N3O
and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-acridin-1-yloxadiazole.
Molecular Properties
| Compound Name | 4-acridin-1-yloxadiazole |
| PubChem CID | 174728572 |
| Molecular Formula | C15H9N3O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4-acridin-1-yloxadiazole |
| SMILES | c1ccc2nc3cccc(-c4conn4)c3cc2c1 |
| InChI | InChI=1S/C15H9N3O/c1-2-6-13-10(4-1)8-12-11(15-9-19-18-17-15)5-3-7-14(12)16-13/h1-9H |
| InChIKey | SEDCWXZPCIYPRG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-acridin-1-yloxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acridin-1-yloxadiazole?
The IUPAC name of 4-acridin-1-yloxadiazole (CID 174728572) is 4-acridin-1-yloxadiazole.
What is the SMILES notation for 4-acridin-1-yloxadiazole?
The canonical SMILES for 4-acridin-1-yloxadiazole is c1ccc2nc3cccc(-c4conn4)c3cc2c1.
What is the InChIKey of 4-acridin-1-yloxadiazole?
The InChIKey is SEDCWXZPCIYPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3O/c1-2-6-13-10(4-1)8-12-11(15-9-19-18-17-15)5-3-7-14(12)16-13/h1-9H.
What are the key properties of 4-acridin-1-yloxadiazole?
4-acridin-1-yloxadiazole has a molecular weight of 247.26 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acridin-1-yloxadiazole is sourced from PubChem (CID 174728572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).