C9H17O7P — CID 174729728
[cyclopropyloxy(hydroxy)phosphoryl] (3R)-3,5-dihydroxy-3-methylpentanoate (PubChem CID 174729728) has the molecular formula C9H17O7P and a molecular weight of 268.20 g/mol. Its IUPAC name is [cyclopropyloxy(hydroxy)phosphoryl] (3R)-3,5-dihydroxy-3-methylpentanoate.
| Compound Name | [cyclopropyloxy(hydroxy)phosphoryl] (3R)-3,5-dihydroxy-3-methylpentanoate |
|---|---|
| PubChem CID | 174729728 |
| Molecular Formula | C9H17O7P |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [cyclopropyloxy(hydroxy)phosphoryl] (3R)-3,5-dihydroxy-3-methylpentanoate |
| SMILES | C[C@@](O)(CCO)CC(=O)OP(=O)(O)OC1CC1 |
| InChI | InChI=1S/C9H17O7P/c1-9(12,4-5-10)6-8(11)16-17(13,14)15-7-2-3-7/h7,10,12H,2-6H2,1H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | BDLPHTQHPDPDMU-SECBINFHSA-N |
| XLogP | 0.33 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|