About N-deca-7,9-dien-2-ylidenehydroxylamine
N-deca-7,9-dien-2-ylidenehydroxylamine (PubChem CID 174730337) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-deca-7,9-dien-2-ylidenehydroxylamine.
Molecular Properties
| Compound Name | N-deca-7,9-dien-2-ylidenehydroxylamine |
| PubChem CID | 174730337 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-deca-7,9-dien-2-ylidenehydroxylamine |
| SMILES | C=CC=CCCCCC(C)=NO |
| InChI | InChI=1S/C10H17NO/c1-3-4-5-6-7-8-9-10(2)11-12/h3-5,12H,1,6-9H2,2H3 |
| InChIKey | JXDCTNIUZXFPDW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-deca-7,9-dien-2-ylidenehydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-deca-7,9-dien-2-ylidenehydroxylamine?
The IUPAC name of N-deca-7,9-dien-2-ylidenehydroxylamine (CID 174730337) is N-deca-7,9-dien-2-ylidenehydroxylamine.
What is the SMILES notation for N-deca-7,9-dien-2-ylidenehydroxylamine?
The canonical SMILES for N-deca-7,9-dien-2-ylidenehydroxylamine is C=CC=CCCCCC(C)=NO.
What is the InChIKey of N-deca-7,9-dien-2-ylidenehydroxylamine?
The InChIKey is JXDCTNIUZXFPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-4-5-6-7-8-9-10(2)11-12/h3-5,12H,1,6-9H2,2H3.
What are the key properties of N-deca-7,9-dien-2-ylidenehydroxylamine?
N-deca-7,9-dien-2-ylidenehydroxylamine has a molecular weight of 167.25 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-deca-7,9-dien-2-ylidenehydroxylamine is sourced from PubChem (CID 174730337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).