About nitroso 3-methyl-2-octylbenzoate
nitroso 3-methyl-2-octylbenzoate (PubChem CID 174730391) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is nitroso 3-methyl-2-octylbenzoate.
Molecular Properties
| Compound Name | nitroso 3-methyl-2-octylbenzoate |
| PubChem CID | 174730391 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | nitroso 3-methyl-2-octylbenzoate |
| SMILES | CCCCCCCCc1c(C)cccc1C(=O)ON=O |
| InChI | InChI=1S/C16H23NO3/c1-3-4-5-6-7-8-11-14-13(2)10-9-12-15(14)16(18)20-17-19/h9-10,12H,3-8,11H2,1-2H3 |
| InChIKey | HXWMDKGRJPBUIB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitroso 3-methyl-2-octylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitroso 3-methyl-2-octylbenzoate?
The IUPAC name of nitroso 3-methyl-2-octylbenzoate (CID 174730391) is nitroso 3-methyl-2-octylbenzoate.
What is the SMILES notation for nitroso 3-methyl-2-octylbenzoate?
The canonical SMILES for nitroso 3-methyl-2-octylbenzoate is CCCCCCCCc1c(C)cccc1C(=O)ON=O.
What is the InChIKey of nitroso 3-methyl-2-octylbenzoate?
The InChIKey is HXWMDKGRJPBUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-3-4-5-6-7-8-11-14-13(2)10-9-12-15(14)16(18)20-17-19/h9-10,12H,3-8,11H2,1-2H3.
What are the key properties of nitroso 3-methyl-2-octylbenzoate?
nitroso 3-methyl-2-octylbenzoate has a molecular weight of 277.36 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitroso 3-methyl-2-octylbenzoate is sourced from PubChem (CID 174730391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).