About (3-methyl-2-octylphenyl) hydrogen carbonate
(3-methyl-2-octylphenyl) hydrogen carbonate (PubChem CID 67179564) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is (3-methyl-2-octylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (3-methyl-2-octylphenyl) hydrogen carbonate |
| PubChem CID | 67179564 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3-methyl-2-octylphenyl) hydrogen carbonate |
| SMILES | CCCCCCCCc1c(C)cccc1OC(=O)O |
| InChI | InChI=1S/C16H24O3/c1-3-4-5-6-7-8-11-14-13(2)10-9-12-15(14)19-16(17)18/h9-10,12H,3-8,11H2,1-2H3,(H,17,18) |
| InChIKey | RQNUGWSGWPMEDX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-2-octylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2-octylphenyl) hydrogen carbonate?
The IUPAC name of (3-methyl-2-octylphenyl) hydrogen carbonate (CID 67179564) is (3-methyl-2-octylphenyl) hydrogen carbonate.
What is the SMILES notation for (3-methyl-2-octylphenyl) hydrogen carbonate?
The canonical SMILES for (3-methyl-2-octylphenyl) hydrogen carbonate is CCCCCCCCc1c(C)cccc1OC(=O)O.
What is the InChIKey of (3-methyl-2-octylphenyl) hydrogen carbonate?
The InChIKey is RQNUGWSGWPMEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-3-4-5-6-7-8-11-14-13(2)10-9-12-15(14)19-16(17)18/h9-10,12H,3-8,11H2,1-2H3,(H,17,18).
What are the key properties of (3-methyl-2-octylphenyl) hydrogen carbonate?
(3-methyl-2-octylphenyl) hydrogen carbonate has a molecular weight of 264.37 g/mol, XLogP of 4.95, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2-octylphenyl) hydrogen carbonate is sourced from PubChem (CID 67179564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).