C22H28O3 — CID 67181691
[2-hexyl-3-(2-propylphenyl)phenyl] hydrogen carbonate (PubChem CID 67181691) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [2-hexyl-3-(2-propylphenyl)phenyl] hydrogen carbonate.
| Compound Name | [2-hexyl-3-(2-propylphenyl)phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67181691 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [2-hexyl-3-(2-propylphenyl)phenyl] hydrogen carbonate |
| SMILES | CCCCCCc1c(OC(=O)O)cccc1-c1ccccc1CCC |
| InChI | InChI=1S/C22H28O3/c1-3-5-6-7-14-20-19(15-10-16-21(20)25-22(23)24)18-13-9-8-12-17(18)11-4-2/h8-10,12-13,15-16H,3-7,11,14H2,1-2H3,(H,23,24) |
| InChIKey | CBOYQACCSFOBPU-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|