C27H38O3 — CID 67179302
[2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate (PubChem CID 67179302) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate.
| Compound Name | [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67179302 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate |
| SMILES | CCCCc1c(OC(=O)O)ccc(-c2cccc(CCC)c2CCC)c1CCCC |
| InChI | InChI=1S/C27H38O3/c1-5-9-15-23-24(18-19-26(30-27(28)29)25(23)16-10-6-2)22-17-11-14-20(12-7-3)21(22)13-8-4/h11,14,17-19H,5-10,12-13,15-16H2,1-4H3,(H,28,29) |
| InChIKey | QBJPTQVDLQWJDW-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|