[2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate

C27H38O3 — CID 67179302

IUPAC[2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate
SMILESCCCCc1c(OC(=O)O)ccc(-c2cccc(CCC)c2CCC)c1CCCC
InChIInChI=1S/C27H38O3/c1-5-9-15-23-24(18-19-26(30-27(28)29)25(23)16-10-6-2)22-17-11-14-20(12-7-3)21(22)13-8-4/h11,14,17-19H,5-10,12-13,15-16H2,1-4H3,(H,28,29)
InChIKeyQBJPTQVDLQWJDW-UHFFFAOYSA-N
MW410.60 g/mol
LogP8.00
Rot. Bonds12

About [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate

[2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate (PubChem CID 67179302) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate.

Molecular Properties

Compound Name[2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate
PubChem CID67179302
Molecular FormulaC27H38O3
Molecular Weight410.60 g/mol
Exact Mass410.28
IUPAC Name[2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate
SMILESCCCCc1c(OC(=O)O)ccc(-c2cccc(CCC)c2CCC)c1CCCC
InChIInChI=1S/C27H38O3/c1-5-9-15-23-24(18-19-26(30-27(28)29)25(23)16-10-6-2)22-17-11-14-20(12-7-3)21(22)13-8-4/h11,14,17-19H,5-10,12-13,15-16H2,1-4H3,(H,28,29)
InChIKeyQBJPTQVDLQWJDW-UHFFFAOYSA-N
XLogP8.00
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500410.60
LogP ≤ 58.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate?
The IUPAC name of [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate (CID 67179302) is [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate.
What is the SMILES notation for [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate?
The canonical SMILES for [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate is CCCCc1c(OC(=O)O)ccc(-c2cccc(CCC)c2CCC)c1CCCC.
What is the InChIKey of [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate?
The InChIKey is QBJPTQVDLQWJDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38O3/c1-5-9-15-23-24(18-19-26(30-27(28)29)25(23)16-10-6-2)22-17-11-14-20(12-7-3)21(22)13-8-4/h11,14,17-19H,5-10,12-13,15-16H2,1-4H3,(H,28,29).
What are the key properties of [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate?
[2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate has a molecular weight of 410.60 g/mol, XLogP of 8.00, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dibutyl-4-(2,3-dipropylphenyl)phenyl] hydrogen carbonate is sourced from PubChem (CID 67179302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).