C29H42O3 — CID 67179264
[4-(2,3-dipropylphenyl)-2,3-dipentylphenyl] hydrogen carbonate (PubChem CID 67179264) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is [4-(2,3-dipropylphenyl)-2,3-dipentylphenyl] hydrogen carbonate.
| Compound Name | [4-(2,3-dipropylphenyl)-2,3-dipentylphenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67179264 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | [4-(2,3-dipropylphenyl)-2,3-dipentylphenyl] hydrogen carbonate |
| SMILES | CCCCCc1c(OC(=O)O)ccc(-c2cccc(CCC)c2CCC)c1CCCCC |
| InChI | InChI=1S/C29H42O3/c1-5-9-11-17-25-26(24-19-13-16-22(14-7-3)23(24)15-8-4)20-21-28(32-29(30)31)27(25)18-12-10-6-2/h13,16,19-21H,5-12,14-15,17-18H2,1-4H3,(H,30,31) |
| InChIKey | JCHRBYTZHUQALP-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|