About [(3S)-morpholin-3-yl] acetate
[(3S)-morpholin-3-yl] acetate (PubChem CID 174732554) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is [(3S)-morpholin-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S)-morpholin-3-yl] acetate |
| PubChem CID | 174732554 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | [(3S)-morpholin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1COCCN1 |
| InChI | InChI=1S/C6H11NO3/c1-5(8)10-6-4-9-3-2-7-6/h6-7H,2-4H2,1H3/t6-/m0/s1 |
| InChIKey | KSGIYAHVKILZFC-LURJTMIESA-N |
| XLogP | -0.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-morpholin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-morpholin-3-yl] acetate?
The IUPAC name of [(3S)-morpholin-3-yl] acetate (CID 174732554) is [(3S)-morpholin-3-yl] acetate.
What is the SMILES notation for [(3S)-morpholin-3-yl] acetate?
The canonical SMILES for [(3S)-morpholin-3-yl] acetate is CC(=O)O[C@H]1COCCN1.
What is the InChIKey of [(3S)-morpholin-3-yl] acetate?
The InChIKey is KSGIYAHVKILZFC-LURJTMIESA-N. The full InChI is InChI=1S/C6H11NO3/c1-5(8)10-6-4-9-3-2-7-6/h6-7H,2-4H2,1H3/t6-/m0/s1.
What are the key properties of [(3S)-morpholin-3-yl] acetate?
[(3S)-morpholin-3-yl] acetate has a molecular weight of 145.16 g/mol, XLogP of -0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-morpholin-3-yl] acetate is sourced from PubChem (CID 174732554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).