C22H25N5O3 — CID 174732919
5-[2-(3,5-dimethoxyphenyl)ethynyl]-7-[2-(2-methoxyethyl)azetidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 174732919) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 5-[2-(3,5-dimethoxyphenyl)ethynyl]-7-[2-(2-methoxyethyl)azetidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-[2-(3,5-dimethoxyphenyl)ethynyl]-7-[2-(2-methoxyethyl)azetidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 174732919 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 5-[2-(3,5-dimethoxyphenyl)ethynyl]-7-[2-(2-methoxyethyl)azetidin-3-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COCCC1NCC1n1cc(C#Cc2cc(OC)cc(OC)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C22H25N5O3/c1-28-7-6-18-19(11-24-18)27-12-15(20-21(23)25-13-26-22(20)27)5-4-14-8-16(29-2)10-17(9-14)30-3/h8-10,12-13,18-19,24H,6-7,11H2,1-3H3,(H2,23,25,26) |
| InChIKey | CMNNSKCBARFFDY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|