About 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene
2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene (PubChem CID 174733860) has the molecular formula C20H23N5O2
and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene.
Molecular Properties
| Compound Name | 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene |
| PubChem CID | 174733860 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene |
| SMILES | Cc1cccc(C)c1.NC(=O)C(Nc1nccc(N)n1)c1cccc(O)c1 |
| InChI | InChI=1S/C12H13N5O2.C8H10/c13-9-4-5-15-12(16-9)17-10(11(14)19)7-2-1-3-8(18)6-7;1-7-4-3-5-8(2)6-7/h1-6,10,18H,(H2,14,19)(H3,13,15,16,17);3-6H,1-2H3 |
| InChIKey | KRYMKWNLFLHVKA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene?
The IUPAC name of 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene (CID 174733860) is 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene.
What is the SMILES notation for 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene?
The canonical SMILES for 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene is Cc1cccc(C)c1.NC(=O)C(Nc1nccc(N)n1)c1cccc(O)c1.
What is the InChIKey of 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene?
The InChIKey is KRYMKWNLFLHVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O2.C8H10/c13-9-4-5-15-12(16-9)17-10(11(14)19)7-2-1-3-8(18)6-7;1-7-4-3-5-8(2)6-7/h1-6,10,18H,(H2,14,19)(H3,13,15,16,17);3-6H,1-2H3.
What are the key properties of 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene?
2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene has a molecular weight of 365.44 g/mol, XLogP of 2.71, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-aminopyrimidin-2-yl)amino]-2-(3-hydroxyphenyl)acetamide;1,3-xylene is sourced from PubChem (CID 174733860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).