C21H28 — CID 174736945
1,1'-biphenyl;4-methyloct-2-ene (PubChem CID 174736945) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1,1'-biphenyl;4-methyloct-2-ene.
| Compound Name | 1,1'-biphenyl;4-methyloct-2-ene |
|---|---|
| PubChem CID | 174736945 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1,1'-biphenyl;4-methyloct-2-ene |
| SMILES | CC=CC(C)CCCC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C9H18/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-6-8-9(3)7-5-2/h1-10H;5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | XZDFSZAEGMMUBO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|