C10H12N2O2 — CID 174738125
3,4-dimethoxy-4H-quinazoline (PubChem CID 174738125) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3,4-dimethoxy-4H-quinazoline.
| Compound Name | 3,4-dimethoxy-4H-quinazoline |
|---|---|
| PubChem CID | 174738125 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3,4-dimethoxy-4H-quinazoline |
| SMILES | COC1c2ccccc2N=CN1OC |
| InChI | InChI=1S/C10H12N2O2/c1-13-10-8-5-3-4-6-9(8)11-7-12(10)14-2/h3-7,10H,1-2H3 |
| InChIKey | MYDUDWJSAUASRC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |