C22H34N6O2 — CID 174740834
tert-butyl formate;5,6-dimethyl-4-N-piperidin-4-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 174740834) has the molecular formula C22H34N6O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl formate;5,6-dimethyl-4-N-piperidin-4-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | tert-butyl formate;5,6-dimethyl-4-N-piperidin-4-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174740834 |
| Molecular Formula | C22H34N6O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | tert-butyl formate;5,6-dimethyl-4-N-piperidin-4-yl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)(C)OC=O.Cc1nc(NCc2ccccn2)nc(NC2CCNCC2)c1C |
| InChI | InChI=1S/C17H24N6.C5H10O2/c1-12-13(2)21-17(20-11-15-5-3-4-8-19-15)23-16(12)22-14-6-9-18-10-7-14;1-5(2,3)7-4-6/h3-5,8,14,18H,6-7,9-11H2,1-2H3,(H2,20,21,22,23);4H,1-3H3 |
| InChIKey | CACPKLFHLRLDGS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|