C17H27BrN2O2 — CID 174709492
N-[(3-bromophenyl)methyl]piperidin-4-amine;tert-butyl formate (PubChem CID 174709492) has the molecular formula C17H27BrN2O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]piperidin-4-amine;tert-butyl formate.
| Compound Name | N-[(3-bromophenyl)methyl]piperidin-4-amine;tert-butyl formate |
|---|---|
| PubChem CID | 174709492 |
| Molecular Formula | C17H27BrN2O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[(3-bromophenyl)methyl]piperidin-4-amine;tert-butyl formate |
| SMILES | Brc1cccc(CNC2CCNCC2)c1.CC(C)(C)OC=O |
| InChI | InChI=1S/C12H17BrN2.C5H10O2/c13-11-3-1-2-10(8-11)9-15-12-4-6-14-7-5-12;1-5(2,3)7-4-6/h1-3,8,12,14-15H,4-7,9H2;4H,1-3H3 |
| InChIKey | HZYXKTSTTJFYPJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|