About 1-(tert-butylamino)propyl trimethoxy silicate
1-(tert-butylamino)propyl trimethoxy silicate (PubChem CID 174742831) has the molecular formula C10H25NO7Si
and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-(tert-butylamino)propyl trimethoxy silicate.
Molecular Properties
| Compound Name | 1-(tert-butylamino)propyl trimethoxy silicate |
| PubChem CID | 174742831 |
| Molecular Formula | C10H25NO7Si |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(tert-butylamino)propyl trimethoxy silicate |
| SMILES | CCC(NC(C)(C)C)O[Si](OOC)(OOC)OOC |
| InChI | InChI=1S/C10H25NO7Si/c1-8-9(11-10(2,3)4)15-19(16-12-5,17-13-6)18-14-7/h9,11H,8H2,1-7H3 |
| InChIKey | FRKGOEGPULQVQE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(tert-butylamino)propyl trimethoxy silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tert-butylamino)propyl trimethoxy silicate?
The IUPAC name of 1-(tert-butylamino)propyl trimethoxy silicate (CID 174742831) is 1-(tert-butylamino)propyl trimethoxy silicate.
What is the SMILES notation for 1-(tert-butylamino)propyl trimethoxy silicate?
The canonical SMILES for 1-(tert-butylamino)propyl trimethoxy silicate is CCC(NC(C)(C)C)O[Si](OOC)(OOC)OOC.
What is the InChIKey of 1-(tert-butylamino)propyl trimethoxy silicate?
The InChIKey is FRKGOEGPULQVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25NO7Si/c1-8-9(11-10(2,3)4)15-19(16-12-5,17-13-6)18-14-7/h9,11H,8H2,1-7H3.
What are the key properties of 1-(tert-butylamino)propyl trimethoxy silicate?
1-(tert-butylamino)propyl trimethoxy silicate has a molecular weight of 299.40 g/mol, XLogP of 1.30, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tert-butylamino)propyl trimethoxy silicate is sourced from PubChem (CID 174742831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).