About 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene
4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene (PubChem CID 174746798) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene.
Analyze 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene?
The IUPAC name of 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene (CID 174746798) is 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene.
What is the SMILES notation for 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene?
The canonical SMILES for 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene is c1c2cc3[nH]ncc3c1C2.
What is the InChIKey of 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene?
The InChIKey is KUYXAMMKWMQQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-5-2-6(1)7-4-9-10-8(7)3-5/h1,3-4H,2H2,(H,9,10).
What are the key properties of 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene?
4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene has a molecular weight of 130.15 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diazatricyclo[6.1.1.02,6]deca-1,3,6,8-tetraene is sourced from PubChem (CID 174746798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).