C10H9ClN2O — CID 138580255
1-(6-chloro-1H-indazol-4-yl)cyclopropan-1-ol (PubChem CID 138580255) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 1-(6-chloro-1H-indazol-4-yl)cyclopropan-1-ol.
| Compound Name | 1-(6-chloro-1H-indazol-4-yl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 138580255 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 1-(6-chloro-1H-indazol-4-yl)cyclopropan-1-ol |
| SMILES | OC1(c2cc(Cl)cc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C10H9ClN2O/c11-6-3-8(10(14)1-2-10)7-5-12-13-9(7)4-6/h3-5,14H,1-2H2,(H,12,13) |
| InChIKey | KWACWBZLLRHACB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |