C19H22ClN3O3 — CID 138580465
[(3aR,6aS)-5-(6-chloro-1H-indazol-4-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(oxolan-3-yl)methanone (PubChem CID 138580465) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is [(3aR,6aS)-5-(6-chloro-1H-indazol-4-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(oxolan-3-yl)methanone.
| Compound Name | [(3aR,6aS)-5-(6-chloro-1H-indazol-4-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 138580465 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(3aR,6aS)-5-(6-chloro-1H-indazol-4-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(oxolan-3-yl)methanone |
| SMILES | O=C(C1CCOC1)N1C[C@@H]2CC(O)(c3cc(Cl)cc4[nH]ncc34)C[C@@H]2C1 |
| InChI | InChI=1S/C19H22ClN3O3/c20-14-3-16(15-7-21-22-17(15)4-14)19(25)5-12-8-23(9-13(12)6-19)18(24)11-1-2-26-10-11/h3-4,7,11-13,25H,1-2,5-6,8-10H2,(H,21,22)/t11?,12-,13+,19? |
| InChIKey | LXJMXMIXFVCJKI-ZCXICMAXSA-N |
| XLogP | 2.31 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |