C20H20ClN3O3S — CID 175478110
2-(benzenesulfonyl)-5-(6-chloro-1H-indazol-4-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol (PubChem CID 175478110) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-(6-chloro-1H-indazol-4-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol.
| Compound Name | 2-(benzenesulfonyl)-5-(6-chloro-1H-indazol-4-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 175478110 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(benzenesulfonyl)-5-(6-chloro-1H-indazol-4-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
| SMILES | O=S(=O)(c1ccccc1)N1CC2CC(O)(c3cc(Cl)cc4[nH]ncc34)CC2C1 |
| InChI | InChI=1S/C20H20ClN3O3S/c21-15-6-18(17-10-22-23-19(17)7-15)20(25)8-13-11-24(12-14(13)9-20)28(26,27)16-4-2-1-3-5-16/h1-7,10,13-14,25H,8-9,11-12H2,(H,22,23) |
| InChIKey | NHQKKNXSNJTIKE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |