C14H17Cl2N3O — CID 155631307
6-(aminomethyl)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexan-3-ol;hydrochloride (PubChem CID 155631307) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 6-(aminomethyl)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexan-3-ol;hydrochloride.
| Compound Name | 6-(aminomethyl)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 155631307 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 6-(aminomethyl)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexan-3-ol;hydrochloride |
| SMILES | Cl.NCC1C2CC(O)(c3cc(Cl)cc4[nH]ncc34)CC12 |
| InChI | InChI=1S/C14H16ClN3O.ClH/c15-7-1-12(11-6-17-18-13(11)2-7)14(19)3-8-9(4-14)10(8)5-16;/h1-2,6,8-10,19H,3-5,16H2,(H,17,18);1H |
| InChIKey | CYCOZPJQXNFGJZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |