C13H13ClN2O2 — CID 155231247
(1S,5R)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexane-3,6-diol (PubChem CID 155231247) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is (1S,5R)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexane-3,6-diol.
| Compound Name | (1S,5R)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexane-3,6-diol |
|---|---|
| PubChem CID | 155231247 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (1S,5R)-3-(6-chloro-1H-indazol-4-yl)bicyclo[3.1.0]hexane-3,6-diol |
| SMILES | OC1[C@H]2CC(O)(c3cc(Cl)cc4[nH]ncc34)C[C@@H]12 |
| InChI | InChI=1S/C13H13ClN2O2/c14-6-1-10(9-5-15-16-11(9)2-6)13(18)3-7-8(4-13)12(7)17/h1-2,5,7-8,12,17-18H,3-4H2,(H,15,16)/t7-,8+,12?,13? |
| InChIKey | BRFXHICARVFALO-WTDALBQZSA-N |
| XLogP | 1.80 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |