C28H22O3 — CID 174747759
9,9-bis(4-methoxyphenyl)fluorene-2-carbaldehyde (PubChem CID 174747759) has the molecular formula C28H22O3 and a molecular weight of 406.48 g/mol. Its IUPAC name is 9,9-bis(4-methoxyphenyl)fluorene-2-carbaldehyde.
| Compound Name | 9,9-bis(4-methoxyphenyl)fluorene-2-carbaldehyde |
|---|---|
| PubChem CID | 174747759 |
| Molecular Formula | C28H22O3 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 9,9-bis(4-methoxyphenyl)fluorene-2-carbaldehyde |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)c3ccccc3-c3ccc(C=O)cc32)cc1 |
| InChI | InChI=1S/C28H22O3/c1-30-22-12-8-20(9-13-22)28(21-10-14-23(31-2)15-11-21)26-6-4-3-5-24(26)25-16-7-19(18-29)17-27(25)28/h3-18H,1-2H3 |
| InChIKey | ZTFCMBUTYAGSQP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|