C29H16O4 — CID 14334392
9,9'-spirobi[fluorene]-2,2',7,7'-tetracarbaldehyde (PubChem CID 14334392) has the molecular formula C29H16O4 and a molecular weight of 428.44 g/mol. Its IUPAC name is 9,9'-spirobi[fluorene]-2,2',7,7'-tetracarbaldehyde.
| Compound Name | 9,9'-spirobi[fluorene]-2,2',7,7'-tetracarbaldehyde |
|---|---|
| PubChem CID | 14334392 |
| Molecular Formula | C29H16O4 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 9,9'-spirobi[fluorene]-2,2',7,7'-tetracarbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C1(c3cc(C=O)ccc3-2)c2cc(C=O)ccc2-c2ccc(C=O)cc21 |
| InChI | InChI=1S/C29H16O4/c30-13-17-1-5-21-22-6-2-18(14-31)10-26(22)29(25(21)9-17)27-11-19(15-32)3-7-23(27)24-8-4-20(16-33)12-28(24)29/h1-16H |
| InChIKey | LSYPGFOPUQWATH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|