C29H24O3 — CID 71560741
(1S,8S,15S)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-tricarbaldehyde (PubChem CID 71560741) has the molecular formula C29H24O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (1S,8S,15S)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-tricarbaldehyde.
| Compound Name | (1S,8S,15S)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-tricarbaldehyde |
|---|---|
| PubChem CID | 71560741 |
| Molecular Formula | C29H24O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (1S,8S,15S)-1,8,15,22-tetramethylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2(7),3,5,9(14),10,12,16(21),17,19-nonaene-4,11,18-tricarbaldehyde |
| SMILES | CC12[C@@]3(C)c4ccc(C=O)cc4[C@]1(C)c1ccc(C=O)cc1[C@]2(C)c1ccc(C=O)cc13 |
| InChI | InChI=1S/C29H24O3/c1-26-20-8-5-18(15-31)12-24(20)28(3)22-10-7-19(16-32)13-25(22)27(2,29(26,28)4)21-9-6-17(14-30)11-23(21)26/h5-16H,1-4H3/t26-,27-,28-,29?/m0/s1 |
| InChIKey | JLZJDZYPOYCVQZ-QNKVVAGZSA-N |
| XLogP | 5.39 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|