About N,N-dimethylthiohydroxylamine;methoxysilane
N,N-dimethylthiohydroxylamine;methoxysilane (PubChem CID 174748218) has the molecular formula C3H13NOSSi
and a molecular weight of 139.30 g/mol. Its IUPAC name is N,N-dimethylthiohydroxylamine;methoxysilane.
Molecular Properties
| Compound Name | N,N-dimethylthiohydroxylamine;methoxysilane |
| PubChem CID | 174748218 |
| Molecular Formula | C3H13NOSSi |
| Molecular Weight | 139.30 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | N,N-dimethylthiohydroxylamine;methoxysilane |
| SMILES | CN(C)S.CO[SiH3] |
| InChI | InChI=1S/C2H7NS.CH6OSi/c1-3(2)4;1-2-3/h4H,1-2H3;1,3H3 |
| InChIKey | YPGKMANWIBZWNY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.30 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylthiohydroxylamine;methoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylthiohydroxylamine;methoxysilane?
The IUPAC name of N,N-dimethylthiohydroxylamine;methoxysilane (CID 174748218) is N,N-dimethylthiohydroxylamine;methoxysilane.
What is the SMILES notation for N,N-dimethylthiohydroxylamine;methoxysilane?
The canonical SMILES for N,N-dimethylthiohydroxylamine;methoxysilane is CN(C)S.CO[SiH3].
What is the InChIKey of N,N-dimethylthiohydroxylamine;methoxysilane?
The InChIKey is YPGKMANWIBZWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NS.CH6OSi/c1-3(2)4;1-2-3/h4H,1-2H3;1,3H3.
What are the key properties of N,N-dimethylthiohydroxylamine;methoxysilane?
N,N-dimethylthiohydroxylamine;methoxysilane has a molecular weight of 139.30 g/mol, XLogP of -0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylthiohydroxylamine;methoxysilane is sourced from PubChem (CID 174748218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).