C9H14N2O2S — CID 174748339
4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]piperidin-4-ol (PubChem CID 174748339) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]piperidin-4-ol.
| Compound Name | 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 174748339 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]piperidin-4-ol |
| SMILES | OCc1csc(C2(O)CCNCC2)n1 |
| InChI | InChI=1S/C9H14N2O2S/c12-5-7-6-14-8(11-7)9(13)1-3-10-4-2-9/h6,10,12-13H,1-5H2 |
| InChIKey | FVMXWPSLIAXIAV-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |