C10H11F2NO3 — CID 174748445
2-(4-amino-2,3-difluorophenoxy)ethyl acetate (PubChem CID 174748445) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-(4-amino-2,3-difluorophenoxy)ethyl acetate.
| Compound Name | 2-(4-amino-2,3-difluorophenoxy)ethyl acetate |
|---|---|
| PubChem CID | 174748445 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-(4-amino-2,3-difluorophenoxy)ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(N)c(F)c1F |
| InChI | InChI=1S/C10H11F2NO3/c1-6(14)15-4-5-16-8-3-2-7(13)9(11)10(8)12/h2-3H,4-5,13H2,1H3 |
| InChIKey | IFTAFOFKKYWCKF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|