C11H11F2NO3S — CID 174551104
[2,3-difluoro-4-(methylcarbamothioyl)phenoxy]methyl acetate (PubChem CID 174551104) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is [2,3-difluoro-4-(methylcarbamothioyl)phenoxy]methyl acetate.
| Compound Name | [2,3-difluoro-4-(methylcarbamothioyl)phenoxy]methyl acetate |
|---|---|
| PubChem CID | 174551104 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | [2,3-difluoro-4-(methylcarbamothioyl)phenoxy]methyl acetate |
| SMILES | CNC(=S)c1ccc(OCOC(C)=O)c(F)c1F |
| InChI | InChI=1S/C11H11F2NO3S/c1-6(15)16-5-17-8-4-3-7(11(18)14-2)9(12)10(8)13/h3-4H,5H2,1-2H3,(H,14,18) |
| InChIKey | DQKTXDOKXHQWFC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|