C9H13N5O — CID 174749174
6-(1-amino-2-methylpropyl)-1,7-dihydropurin-2-one (PubChem CID 174749174) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 6-(1-amino-2-methylpropyl)-1,7-dihydropurin-2-one.
| Compound Name | 6-(1-amino-2-methylpropyl)-1,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 174749174 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 6-(1-amino-2-methylpropyl)-1,7-dihydropurin-2-one |
| SMILES | CC(C)C(N)c1[nH]c(=O)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H13N5O/c1-4(2)5(10)6-7-8(12-3-11-7)14-9(15)13-6/h3-5H,10H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | YWEKEAZFKCIWAN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |