C11H16BrNO4 — CID 174749631
2-amino-2-methylpropane-1,3-diol;5-bromo-2-hydroxybenzaldehyde (PubChem CID 174749631) has the molecular formula C11H16BrNO4 and a molecular weight of 306.16 g/mol. Its IUPAC name is 2-amino-2-methylpropane-1,3-diol;5-bromo-2-hydroxybenzaldehyde.
| Compound Name | 2-amino-2-methylpropane-1,3-diol;5-bromo-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 174749631 |
| Molecular Formula | C11H16BrNO4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-amino-2-methylpropane-1,3-diol;5-bromo-2-hydroxybenzaldehyde |
| SMILES | CC(N)(CO)CO.O=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C7H5BrO2.C4H11NO2/c8-6-1-2-7(10)5(3-6)4-9;1-4(5,2-6)3-7/h1-4,10H;6-7H,2-3,5H2,1H3 |
| InChIKey | ZFCCSOSWLAETOV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|