C21H26O5 — CID 174750919
5-methylbenzene-1,3-dicarboxylic acid;1-phenylhexan-3-ol (PubChem CID 174750919) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 5-methylbenzene-1,3-dicarboxylic acid;1-phenylhexan-3-ol.
| Compound Name | 5-methylbenzene-1,3-dicarboxylic acid;1-phenylhexan-3-ol |
|---|---|
| PubChem CID | 174750919 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-methylbenzene-1,3-dicarboxylic acid;1-phenylhexan-3-ol |
| SMILES | CCCC(O)CCc1ccccc1.Cc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H18O.C9H8O4/c1-2-6-12(13)10-9-11-7-4-3-5-8-11;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h3-5,7-8,12-13H,2,6,9-10H2,1H3;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | HUAIMMYROLLBMT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |