About 1-phenylpropyl butaneperoxoate
1-phenylpropyl butaneperoxoate (PubChem CID 174751754) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-phenylpropyl butaneperoxoate.
Molecular Properties
| Compound Name | 1-phenylpropyl butaneperoxoate |
| PubChem CID | 174751754 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-phenylpropyl butaneperoxoate |
| SMILES | CCCC(=O)OOC(CC)c1ccccc1 |
| InChI | InChI=1S/C13H18O3/c1-3-8-13(14)16-15-12(4-2)11-9-6-5-7-10-11/h5-7,9-10,12H,3-4,8H2,1-2H3 |
| InChIKey | BHEZCWLLSHOLKS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpropyl butaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropyl butaneperoxoate?
The IUPAC name of 1-phenylpropyl butaneperoxoate (CID 174751754) is 1-phenylpropyl butaneperoxoate.
What is the SMILES notation for 1-phenylpropyl butaneperoxoate?
The canonical SMILES for 1-phenylpropyl butaneperoxoate is CCCC(=O)OOC(CC)c1ccccc1.
What is the InChIKey of 1-phenylpropyl butaneperoxoate?
The InChIKey is BHEZCWLLSHOLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-3-8-13(14)16-15-12(4-2)11-9-6-5-7-10-11/h5-7,9-10,12H,3-4,8H2,1-2H3.
What are the key properties of 1-phenylpropyl butaneperoxoate?
1-phenylpropyl butaneperoxoate has a molecular weight of 222.28 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropyl butaneperoxoate is sourced from PubChem (CID 174751754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).